About 2-(2-anilino-4-phenyl-1,3-thiazol-5-yl)-3-(2-methylphenyl)quinazolin-4-one
2-(2-anilino-4-phenyl-1,3-thiazol-5-yl)-3-(2-methylphenyl)quinazolin-4-one (PubChem CID 11842419) has the molecular formula C30H22N4OS
and a molecular weight of 486.60 g/mol. Its IUPAC name is 2-(2-anilino-4-phenyl-1,3-thiazol-5-yl)-3-(2-methylphenyl)quinazolin-4-one.
Molecular Properties
| Compound Name | 2-(2-anilino-4-phenyl-1,3-thiazol-5-yl)-3-(2-methylphenyl)quinazolin-4-one |
| PubChem CID | 11842419 |
| Molecular Formula | C30H22N4OS |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 2-(2-anilino-4-phenyl-1,3-thiazol-5-yl)-3-(2-methylphenyl)quinazolin-4-one |
| SMILES | Cc1ccccc1-n1c(-c2sc(Nc3ccccc3)nc2-c2ccccc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C30H22N4OS/c1-20-12-8-11-19-25(20)34-28(32-24-18-10-9-17-23(24)29(34)35)27-26(21-13-4-2-5-14-21)33-30(36-27)31-22-15-6-3-7-16-22/h2-19H,1H3,(H,31,33) |
| InChIKey | HSZBDYOXWPKWBP-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(2-anilino-4-phenyl-1,3-thiazol-5-yl)-3-(2-methylphenyl)quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-anilino-4-phenyl-1,3-thiazol-5-yl)-3-(2-methylphenyl)quinazolin-4-one?
The IUPAC name of 2-(2-anilino-4-phenyl-1,3-thiazol-5-yl)-3-(2-methylphenyl)quinazolin-4-one (CID 11842419) is 2-(2-anilino-4-phenyl-1,3-thiazol-5-yl)-3-(2-methylphenyl)quinazolin-4-one.
What is the SMILES notation for 2-(2-anilino-4-phenyl-1,3-thiazol-5-yl)-3-(2-methylphenyl)quinazolin-4-one?
The canonical SMILES for 2-(2-anilino-4-phenyl-1,3-thiazol-5-yl)-3-(2-methylphenyl)quinazolin-4-one is Cc1ccccc1-n1c(-c2sc(Nc3ccccc3)nc2-c2ccccc2)nc2ccccc2c1=O.
What is the InChIKey of 2-(2-anilino-4-phenyl-1,3-thiazol-5-yl)-3-(2-methylphenyl)quinazolin-4-one?
The InChIKey is HSZBDYOXWPKWBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H22N4OS/c1-20-12-8-11-19-25(20)34-28(32-24-18-10-9-17-23(24)29(34)35)27-26(21-13-4-2-5-14-21)33-30(36-27)31-22-15-6-3-7-16-22/h2-19H,1H3,(H,31,33).
What are the key properties of 2-(2-anilino-4-phenyl-1,3-thiazol-5-yl)-3-(2-methylphenyl)quinazolin-4-one?
2-(2-anilino-4-phenyl-1,3-thiazol-5-yl)-3-(2-methylphenyl)quinazolin-4-one has a molecular weight of 486.60 g/mol, XLogP of 7.23, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-anilino-4-phenyl-1,3-thiazol-5-yl)-3-(2-methylphenyl)quinazolin-4-one is sourced from PubChem (CID 11842419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).