C11H18O4 — CID 118424603
ethyl 2-[(3R,3aR,6aR)-3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]acetate (PubChem CID 118424603) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is ethyl 2-[(3R,3aR,6aR)-3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]acetate.
| Compound Name | ethyl 2-[(3R,3aR,6aR)-3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]acetate |
|---|---|
| PubChem CID | 118424603 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | ethyl 2-[(3R,3aR,6aR)-3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]acetate |
| SMILES | CCOC(=O)CC1CO[C@@H]2[C@H](C)CO[C@H]12 |
| InChI | InChI=1S/C11H18O4/c1-3-13-9(12)4-8-6-15-10-7(2)5-14-11(8)10/h7-8,10-11H,3-6H2,1-2H3/t7-,8?,10-,11-/m1/s1 |
| InChIKey | QUXJIRUNHSSVBR-WAOAVRLKSA-N |
| XLogP | 0.99 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |