C28H26ClN3O6 — CID 118424618
4-[4-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]phenyl]phenyl]butanoic acid (PubChem CID 118424618) has the molecular formula C28H26ClN3O6 and a molecular weight of 535.98 g/mol. Its IUPAC name is 4-[4-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]phenyl]phenyl]butanoic acid.
| Compound Name | 4-[4-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]phenyl]phenyl]butanoic acid |
|---|---|
| PubChem CID | 118424618 |
| Molecular Formula | C28H26ClN3O6 |
| Molecular Weight | 535.98 g/mol |
| Exact Mass | 535.15 |
| IUPAC Name | 4-[4-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]phenyl]phenyl]butanoic acid |
| SMILES | O=C(O)CCCc1ccc(-c2ccc(-c3nc4nc(O[C@@H]5CO[C@H]6[C@@H]5OC[C@H]6O)[nH]c4cc3Cl)cc2)cc1 |
| InChI | InChI=1S/C28H26ClN3O6/c29-19-12-20-27(32-28(30-20)38-22-14-37-25-21(33)13-36-26(22)25)31-24(19)18-10-8-17(9-11-18)16-6-4-15(5-7-16)2-1-3-23(34)35/h4-12,21-22,25-26,33H,1-3,13-14H2,(H,34,35)(H,30,31,32)/t21-,22-,25-,26-/m1/s1 |
| InChIKey | AIHSPYCHIJSRJH-SAZLYLDSSA-N |
| XLogP | 4.26 |
| TPSA | 126.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.98 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |