C20H20ClN5O2S2 — CID 118424768
(5S)-5-[3-chloro-7-(6-cyclopropyl-3-pyridinyl)thieno[2,3-c]pyridin-2-yl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine (PubChem CID 118424768) has the molecular formula C20H20ClN5O2S2 and a molecular weight of 462.00 g/mol. Its IUPAC name is (5S)-5-[3-chloro-7-(6-cyclopropyl-3-pyridinyl)thieno[2,3-c]pyridin-2-yl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine.
| Compound Name | (5S)-5-[3-chloro-7-(6-cyclopropyl-3-pyridinyl)thieno[2,3-c]pyridin-2-yl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine |
|---|---|
| PubChem CID | 118424768 |
| Molecular Formula | C20H20ClN5O2S2 |
| Molecular Weight | 462.00 g/mol |
| Exact Mass | 461.07 |
| IUPAC Name | (5S)-5-[3-chloro-7-(6-cyclopropyl-3-pyridinyl)thieno[2,3-c]pyridin-2-yl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine |
| SMILES | CN1C(N)=N[C@](C)(c2sc3c(-c4ccc(C5CC5)nc4)nccc3c2Cl)CS1(=O)=O |
| InChI | InChI=1S/C20H20ClN5O2S2/c1-20(10-30(27,28)26(2)19(22)25-20)18-15(21)13-7-8-23-16(17(13)29-18)12-5-6-14(24-9-12)11-3-4-11/h5-9,11H,3-4,10H2,1-2H3,(H2,22,25)/t20-/m0/s1 |
| InChIKey | NELPKQXZEKWLDZ-FQEVSTJZSA-N |
| XLogP | 3.69 |
| TPSA | 101.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.00 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |