C21H18ClN5O2S3 — CID 118424774
(5S)-5-[3-chloro-7-[4-(1,3-thiazol-2-yl)phenyl]thieno[2,3-c]pyridin-2-yl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine (PubChem CID 118424774) has the molecular formula C21H18ClN5O2S3 and a molecular weight of 504.06 g/mol. Its IUPAC name is (5S)-5-[3-chloro-7-[4-(1,3-thiazol-2-yl)phenyl]thieno[2,3-c]pyridin-2-yl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine.
| Compound Name | (5S)-5-[3-chloro-7-[4-(1,3-thiazol-2-yl)phenyl]thieno[2,3-c]pyridin-2-yl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine |
|---|---|
| PubChem CID | 118424774 |
| Molecular Formula | C21H18ClN5O2S3 |
| Molecular Weight | 504.06 g/mol |
| Exact Mass | 503.03 |
| IUPAC Name | (5S)-5-[3-chloro-7-[4-(1,3-thiazol-2-yl)phenyl]thieno[2,3-c]pyridin-2-yl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine |
| SMILES | CN1C(N)=N[C@](C)(c2sc3c(-c4ccc(-c5nccs5)cc4)nccc3c2Cl)CS1(=O)=O |
| InChI | InChI=1S/C21H18ClN5O2S3/c1-21(11-32(28,29)27(2)20(23)26-21)18-15(22)14-7-8-24-16(17(14)31-18)12-3-5-13(6-4-12)19-25-9-10-30-19/h3-10H,11H2,1-2H3,(H2,23,26)/t21-/m0/s1 |
| InChIKey | XVXOYHWXCCEZTG-NRFANRHFSA-N |
| XLogP | 4.55 |
| TPSA | 101.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.06 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |