C26H26F3N7O2 — CID 118425312
trans-(1S,3R)-3-N-[4-(1H-indol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]-1-methyl-1-N-[(5-nitro-2-pyridinyl)methyl]cyclohexane-1,3-diamine (PubChem CID 118425312) has the molecular formula C26H26F3N7O2 and a molecular weight of 525.54 g/mol. Its IUPAC name is trans-(1S,3R)-3-N-[4-(1H-indol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]-1-methyl-1-N-[(5-nitro-2-pyridinyl)methyl]cyclohexane-1,3-diamine.
| Compound Name | trans-(1S,3R)-3-N-[4-(1H-indol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]-1-methyl-1-N-[(5-nitro-2-pyridinyl)methyl]cyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 118425312 |
| Molecular Formula | C26H26F3N7O2 |
| Molecular Weight | 525.54 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | trans-(1S,3R)-3-N-[4-(1H-indol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]-1-methyl-1-N-[(5-nitro-2-pyridinyl)methyl]cyclohexane-1,3-diamine |
| SMILES | C[C@]1(NCc2ccc([N+](=O)[O-])cn2)CCC[C@@H](Nc2ncc(C(F)(F)F)c(-c3c[nH]c4ccccc34)n2)C1 |
| InChI | InChI=1S/C26H26F3N7O2/c1-25(33-12-17-8-9-18(13-30-17)36(37)38)10-4-5-16(11-25)34-24-32-15-21(26(27,28)29)23(35-24)20-14-31-22-7-3-2-6-19(20)22/h2-3,6-9,13-16,31,33H,4-5,10-12H2,1H3,(H,32,34,35)/t16-,25+/m1/s1 |
| InChIKey | PFPLFINZCQSGDF-CPJLOUKISA-N |
| XLogP | 5.85 |
| TPSA | 121.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.54 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|