About 2-(4-ethylphenyl)-3-[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one
2-(4-ethylphenyl)-3-[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one (PubChem CID 11842543) has the molecular formula C18H16F3NOS
and a molecular weight of 351.39 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-3-[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 2-(4-ethylphenyl)-3-[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one |
| PubChem CID | 11842543 |
| Molecular Formula | C18H16F3NOS |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 2-(4-ethylphenyl)-3-[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one |
| SMILES | CCc1ccc(C2SCC(=O)N2c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H16F3NOS/c1-2-12-3-5-13(6-4-12)17-22(16(23)11-24-17)15-9-7-14(8-10-15)18(19,20)21/h3-10,17H,2,11H2,1H3 |
| InChIKey | XGLRTFOYVXLCDT-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-ethylphenyl)-3-[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethylphenyl)-3-[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one?
The IUPAC name of 2-(4-ethylphenyl)-3-[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one (CID 11842543) is 2-(4-ethylphenyl)-3-[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one.
What is the SMILES notation for 2-(4-ethylphenyl)-3-[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one?
The canonical SMILES for 2-(4-ethylphenyl)-3-[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one is CCc1ccc(C2SCC(=O)N2c2ccc(C(F)(F)F)cc2)cc1.
What is the InChIKey of 2-(4-ethylphenyl)-3-[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one?
The InChIKey is XGLRTFOYVXLCDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16F3NOS/c1-2-12-3-5-13(6-4-12)17-22(16(23)11-24-17)15-9-7-14(8-10-15)18(19,20)21/h3-10,17H,2,11H2,1H3.
What are the key properties of 2-(4-ethylphenyl)-3-[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one?
2-(4-ethylphenyl)-3-[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one has a molecular weight of 351.39 g/mol, XLogP of 5.05, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethylphenyl)-3-[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one is sourced from PubChem (CID 11842543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).