About 2-(4-fluorophenyl)-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one
2-(4-fluorophenyl)-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one (PubChem CID 11842552) has the molecular formula C12H9FN2OS2
and a molecular weight of 280.35 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 2-(4-fluorophenyl)-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one |
| PubChem CID | 11842552 |
| Molecular Formula | C12H9FN2OS2 |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | 2-(4-fluorophenyl)-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(c2ccc(F)cc2)N1c1nccs1 |
| InChI | InChI=1S/C12H9FN2OS2/c13-9-3-1-8(2-4-9)11-15(10(16)7-18-11)12-14-5-6-17-12/h1-6,11H,7H2 |
| InChIKey | KNMWCHQQDINEFQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-fluorophenyl)-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorophenyl)-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one?
The IUPAC name of 2-(4-fluorophenyl)-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one (CID 11842552) is 2-(4-fluorophenyl)-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one.
What is the SMILES notation for 2-(4-fluorophenyl)-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one?
The canonical SMILES for 2-(4-fluorophenyl)-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one is O=C1CSC(c2ccc(F)cc2)N1c1nccs1.
What is the InChIKey of 2-(4-fluorophenyl)-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one?
The InChIKey is KNMWCHQQDINEFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9FN2OS2/c13-9-3-1-8(2-4-9)11-15(10(16)7-18-11)12-14-5-6-17-12/h1-6,11H,7H2.
What are the key properties of 2-(4-fluorophenyl)-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one?
2-(4-fluorophenyl)-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one has a molecular weight of 280.35 g/mol, XLogP of 3.06, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorophenyl)-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one is sourced from PubChem (CID 11842552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).