C23H13BrF8O4S — CID 118425551
(2,3,4,5,6-pentafluorophenyl) (5R)-5-[2-bromo-4-(trifluoromethyl)phenoxy]-5,6,7,8-tetrahydronaphthalene-2-sulfonate (PubChem CID 118425551) has the molecular formula C23H13BrF8O4S and a molecular weight of 617.31 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) (5R)-5-[2-bromo-4-(trifluoromethyl)phenoxy]-5,6,7,8-tetrahydronaphthalene-2-sulfonate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) (5R)-5-[2-bromo-4-(trifluoromethyl)phenoxy]-5,6,7,8-tetrahydronaphthalene-2-sulfonate |
|---|---|
| PubChem CID | 118425551 |
| Molecular Formula | C23H13BrF8O4S |
| Molecular Weight | 617.31 g/mol |
| Exact Mass | 615.96 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) (5R)-5-[2-bromo-4-(trifluoromethyl)phenoxy]-5,6,7,8-tetrahydronaphthalene-2-sulfonate |
| SMILES | O=S(=O)(Oc1c(F)c(F)c(F)c(F)c1F)c1ccc2c(c1)CCC[C@H]2Oc1ccc(C(F)(F)F)cc1Br |
| InChI | InChI=1S/C23H13BrF8O4S/c24-14-9-11(23(30,31)32)4-7-16(14)35-15-3-1-2-10-8-12(5-6-13(10)15)37(33,34)36-22-20(28)18(26)17(25)19(27)21(22)29/h4-9,15H,1-3H2/t15-/m1/s1 |
| InChIKey | DYLJLNHXBBSZIJ-OAHLLOKOSA-N |
| XLogP | 7.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.31 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|