C27H31N7O2 — CID 118425887
trans-(1S,3R)-3-N-[5-ethyl-4-(1H-indol-3-yl)pyrimidin-2-yl]-1-methyl-1-N-[(5-nitro-2-pyridinyl)methyl]cyclohexane-1,3-diamine (PubChem CID 118425887) has the molecular formula C27H31N7O2 and a molecular weight of 485.59 g/mol. Its IUPAC name is trans-(1S,3R)-3-N-[5-ethyl-4-(1H-indol-3-yl)pyrimidin-2-yl]-1-methyl-1-N-[(5-nitro-2-pyridinyl)methyl]cyclohexane-1,3-diamine.
| Compound Name | trans-(1S,3R)-3-N-[5-ethyl-4-(1H-indol-3-yl)pyrimidin-2-yl]-1-methyl-1-N-[(5-nitro-2-pyridinyl)methyl]cyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 118425887 |
| Molecular Formula | C27H31N7O2 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | trans-(1S,3R)-3-N-[5-ethyl-4-(1H-indol-3-yl)pyrimidin-2-yl]-1-methyl-1-N-[(5-nitro-2-pyridinyl)methyl]cyclohexane-1,3-diamine |
| SMILES | CCc1cnc(N[C@@H]2CCC[C@](C)(NCc3ccc([N+](=O)[O-])cn3)C2)nc1-c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C27H31N7O2/c1-3-18-14-30-26(33-25(18)23-17-29-24-9-5-4-8-22(23)24)32-19-7-6-12-27(2,13-19)31-15-20-10-11-21(16-28-20)34(35)36/h4-5,8-11,14,16-17,19,29,31H,3,6-7,12-13,15H2,1-2H3,(H,30,32,33)/t19-,27+/m1/s1 |
| InChIKey | WPBGHSKHIRHABD-WINIVTDRSA-N |
| XLogP | 5.39 |
| TPSA | 121.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|