C13H16IN4O5P — CID 118426472
1-[2-[[[2-(2,5-dioxopyrrol-1-yl)ethylamino]-(iodomethyl)phosphoryl]amino]ethyl]pyrrole-2,5-dione (PubChem CID 118426472) has the molecular formula C13H16IN4O5P and a molecular weight of 466.17 g/mol. Its IUPAC name is 1-[2-[[[2-(2,5-dioxopyrrol-1-yl)ethylamino]-(iodomethyl)phosphoryl]amino]ethyl]pyrrole-2,5-dione.
| Compound Name | 1-[2-[[[2-(2,5-dioxopyrrol-1-yl)ethylamino]-(iodomethyl)phosphoryl]amino]ethyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 118426472 |
| Molecular Formula | C13H16IN4O5P |
| Molecular Weight | 466.17 g/mol |
| Exact Mass | 465.99 |
| IUPAC Name | 1-[2-[[[2-(2,5-dioxopyrrol-1-yl)ethylamino]-(iodomethyl)phosphoryl]amino]ethyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1CCNP(=O)(CI)NCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C13H16IN4O5P/c14-9-24(23,15-5-7-17-10(19)1-2-11(17)20)16-6-8-18-12(21)3-4-13(18)22/h1-4H,5-9H2,(H2,15,16,23) |
| InChIKey | AJUDJEJQDLGQIS-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.17 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|