About phenyl N-(4,4-difluorocyclohexyl)carbamate
phenyl N-(4,4-difluorocyclohexyl)carbamate (PubChem CID 118426933) has the molecular formula C13H15F2NO2
and a molecular weight of 255.26 g/mol. Its IUPAC name is phenyl N-(4,4-difluorocyclohexyl)carbamate.
Molecular Properties
| Compound Name | phenyl N-(4,4-difluorocyclohexyl)carbamate |
| PubChem CID | 118426933 |
| Molecular Formula | C13H15F2NO2 |
| Molecular Weight | 255.26 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | phenyl N-(4,4-difluorocyclohexyl)carbamate |
| SMILES | O=C(NC1CCC(F)(F)CC1)Oc1ccccc1 |
| InChI | InChI=1S/C13H15F2NO2/c14-13(15)8-6-10(7-9-13)16-12(17)18-11-4-2-1-3-5-11/h1-5,10H,6-9H2,(H,16,17) |
| InChIKey | PYMAQIDIKQXMSN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.26 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze phenyl N-(4,4-difluorocyclohexyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl N-(4,4-difluorocyclohexyl)carbamate?
The IUPAC name of phenyl N-(4,4-difluorocyclohexyl)carbamate (CID 118426933) is phenyl N-(4,4-difluorocyclohexyl)carbamate.
What is the SMILES notation for phenyl N-(4,4-difluorocyclohexyl)carbamate?
The canonical SMILES for phenyl N-(4,4-difluorocyclohexyl)carbamate is O=C(NC1CCC(F)(F)CC1)Oc1ccccc1.
What is the InChIKey of phenyl N-(4,4-difluorocyclohexyl)carbamate?
The InChIKey is PYMAQIDIKQXMSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F2NO2/c14-13(15)8-6-10(7-9-13)16-12(17)18-11-4-2-1-3-5-11/h1-5,10H,6-9H2,(H,16,17).
What are the key properties of phenyl N-(4,4-difluorocyclohexyl)carbamate?
phenyl N-(4,4-difluorocyclohexyl)carbamate has a molecular weight of 255.26 g/mol, XLogP of 3.35, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl N-(4,4-difluorocyclohexyl)carbamate is sourced from PubChem (CID 118426933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).