C26H33N3O3 — CID 118427561
2-[(2-benzyl-1-pentan-3-ylbenzimidazole-5-carbonyl)amino]-4-methylpentanoic acid (PubChem CID 118427561) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is 2-[(2-benzyl-1-pentan-3-ylbenzimidazole-5-carbonyl)amino]-4-methylpentanoic acid.
| Compound Name | 2-[(2-benzyl-1-pentan-3-ylbenzimidazole-5-carbonyl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 118427561 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | 2-[(2-benzyl-1-pentan-3-ylbenzimidazole-5-carbonyl)amino]-4-methylpentanoic acid |
| SMILES | CCC(CC)n1c(Cc2ccccc2)nc2cc(C(=O)NC(CC(C)C)C(=O)O)ccc21 |
| InChI | InChI=1S/C26H33N3O3/c1-5-20(6-2)29-23-13-12-19(25(30)28-22(26(31)32)14-17(3)4)16-21(23)27-24(29)15-18-10-8-7-9-11-18/h7-13,16-17,20,22H,5-6,14-15H2,1-4H3,(H,28,30)(H,31,32) |
| InChIKey | BCXDMNXNQQKYFE-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |