C27H39NO3 — CID 11842792
ethyl (1R,5S,9S)-5-but-3-enyl-9-hydroxy-3-(3-phenylpropyl)-9-prop-2-enyl-3-azabicyclo[3.3.1]nonane-1-carboxylate (PubChem CID 11842792) has the molecular formula C27H39NO3 and a molecular weight of 425.61 g/mol. Its IUPAC name is ethyl (1R,5S,9S)-5-but-3-enyl-9-hydroxy-3-(3-phenylpropyl)-9-prop-2-enyl-3-azabicyclo[3.3.1]nonane-1-carboxylate.
| Compound Name | ethyl (1R,5S,9S)-5-but-3-enyl-9-hydroxy-3-(3-phenylpropyl)-9-prop-2-enyl-3-azabicyclo[3.3.1]nonane-1-carboxylate |
|---|---|
| PubChem CID | 11842792 |
| Molecular Formula | C27H39NO3 |
| Molecular Weight | 425.61 g/mol |
| Exact Mass | 425.29 |
| IUPAC Name | ethyl (1R,5S,9S)-5-but-3-enyl-9-hydroxy-3-(3-phenylpropyl)-9-prop-2-enyl-3-azabicyclo[3.3.1]nonane-1-carboxylate |
| SMILES | C=CCC[C@@]12CCC[C@@](C(=O)OCC)(CN(CCCc3ccccc3)C1)[C@]2(O)CC=C |
| InChI | InChI=1S/C27H39NO3/c1-4-7-17-25-18-12-19-26(24(29)31-6-3,27(25,30)16-5-2)22-28(21-25)20-11-15-23-13-9-8-10-14-23/h4-5,8-10,13-14,30H,1-2,6-7,11-12,15-22H2,3H3/t25-,26+,27+/m1/s1 |
| InChIKey | YCAVCHRTASJDPX-PVHODMMVSA-N |
| XLogP | 4.93 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.61 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|