C25H35NO3 — CID 11842793
ethyl (1S,7S,8R)-7-hydroxy-10-(3-phenylpropyl)-10-azatricyclo[6.3.3.01,7]tetradec-4-ene-8-carboxylate (PubChem CID 11842793) has the molecular formula C25H35NO3 and a molecular weight of 397.56 g/mol. Its IUPAC name is ethyl (1S,7S,8R)-7-hydroxy-10-(3-phenylpropyl)-10-azatricyclo[6.3.3.01,7]tetradec-4-ene-8-carboxylate.
| Compound Name | ethyl (1S,7S,8R)-7-hydroxy-10-(3-phenylpropyl)-10-azatricyclo[6.3.3.01,7]tetradec-4-ene-8-carboxylate |
|---|---|
| PubChem CID | 11842793 |
| Molecular Formula | C25H35NO3 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | ethyl (1S,7S,8R)-7-hydroxy-10-(3-phenylpropyl)-10-azatricyclo[6.3.3.01,7]tetradec-4-ene-8-carboxylate |
| SMILES | CCOC(=O)[C@@]12CCC[C@]3(CCC=CC[C@]31O)CN(CCCc1ccccc1)C2 |
| InChI | InChI=1S/C25H35NO3/c1-2-29-22(27)24-16-10-15-23(14-7-4-8-17-25(23,24)28)19-26(20-24)18-9-13-21-11-5-3-6-12-21/h3-6,8,11-12,28H,2,7,9-10,13-20H2,1H3/t23-,24+,25+/m1/s1 |
| InChIKey | CYFWQFWKZLSGIO-DSITVLBTSA-N |
| XLogP | 4.13 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|