C18H14N4O2 — CID 118428160
3-[(2-cyanophenyl)methyl]-5-methyl-2-pyridin-3-ylimidazole-4-carboxylic acid (PubChem CID 118428160) has the molecular formula C18H14N4O2 and a molecular weight of 318.34 g/mol. Its IUPAC name is 3-[(2-cyanophenyl)methyl]-5-methyl-2-pyridin-3-ylimidazole-4-carboxylic acid.
| Compound Name | 3-[(2-cyanophenyl)methyl]-5-methyl-2-pyridin-3-ylimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 118428160 |
| Molecular Formula | C18H14N4O2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 3-[(2-cyanophenyl)methyl]-5-methyl-2-pyridin-3-ylimidazole-4-carboxylic acid |
| SMILES | Cc1nc(-c2cccnc2)n(Cc2ccccc2C#N)c1C(=O)O |
| InChI | InChI=1S/C18H14N4O2/c1-12-16(18(23)24)22(11-15-6-3-2-5-13(15)9-19)17(21-12)14-7-4-8-20-10-14/h2-8,10H,11H2,1H3,(H,23,24) |
| InChIKey | VMUAJKYBFCQKAY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |