About 5,6-dichloro-2-[(5,6-dichloro-1H-benzimidazol-2-yl)disulfanyl]-1H-benzimidazole
5,6-dichloro-2-[(5,6-dichloro-1H-benzimidazol-2-yl)disulfanyl]-1H-benzimidazole (PubChem CID 118428722) has the molecular formula C14H6Cl4N4S2
and a molecular weight of 436.18 g/mol. Its IUPAC name is 5,6-dichloro-2-[(5,6-dichloro-1H-benzimidazol-2-yl)disulfanyl]-1H-benzimidazole.
Molecular Properties
| Compound Name | 5,6-dichloro-2-[(5,6-dichloro-1H-benzimidazol-2-yl)disulfanyl]-1H-benzimidazole |
| PubChem CID | 118428722 |
| Molecular Formula | C14H6Cl4N4S2 |
| Molecular Weight | 436.18 g/mol |
| Exact Mass | 433.88 |
| IUPAC Name | 5,6-dichloro-2-[(5,6-dichloro-1H-benzimidazol-2-yl)disulfanyl]-1H-benzimidazole |
| SMILES | Clc1cc2nc(SSc3nc4cc(Cl)c(Cl)cc4[nH]3)[nH]c2cc1Cl |
| InChI | InChI=1S/C14H6Cl4N4S2/c15-5-1-9-10(2-6(5)16)20-13(19-9)23-24-14-21-11-3-7(17)8(18)4-12(11)22-14/h1-4H,(H,19,20)(H,21,22) |
| InChIKey | KHNUTDFCMZDGLU-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.18 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dichloro-2-[(5,6-dichloro-1H-benzimidazol-2-yl)disulfanyl]-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dichloro-2-[(5,6-dichloro-1H-benzimidazol-2-yl)disulfanyl]-1H-benzimidazole?
The IUPAC name of 5,6-dichloro-2-[(5,6-dichloro-1H-benzimidazol-2-yl)disulfanyl]-1H-benzimidazole (CID 118428722) is 5,6-dichloro-2-[(5,6-dichloro-1H-benzimidazol-2-yl)disulfanyl]-1H-benzimidazole.
What is the SMILES notation for 5,6-dichloro-2-[(5,6-dichloro-1H-benzimidazol-2-yl)disulfanyl]-1H-benzimidazole?
The canonical SMILES for 5,6-dichloro-2-[(5,6-dichloro-1H-benzimidazol-2-yl)disulfanyl]-1H-benzimidazole is Clc1cc2nc(SSc3nc4cc(Cl)c(Cl)cc4[nH]3)[nH]c2cc1Cl.
What is the InChIKey of 5,6-dichloro-2-[(5,6-dichloro-1H-benzimidazol-2-yl)disulfanyl]-1H-benzimidazole?
The InChIKey is KHNUTDFCMZDGLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H6Cl4N4S2/c15-5-1-9-10(2-6(5)16)20-13(19-9)23-24-14-21-11-3-7(17)8(18)4-12(11)22-14/h1-4H,(H,19,20)(H,21,22).
What are the key properties of 5,6-dichloro-2-[(5,6-dichloro-1H-benzimidazol-2-yl)disulfanyl]-1H-benzimidazole?
5,6-dichloro-2-[(5,6-dichloro-1H-benzimidazol-2-yl)disulfanyl]-1H-benzimidazole has a molecular weight of 436.18 g/mol, XLogP of 6.85, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dichloro-2-[(5,6-dichloro-1H-benzimidazol-2-yl)disulfanyl]-1H-benzimidazole is sourced from PubChem (CID 118428722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).