C21H20F6N2O — CID 118428793
N-[1-[[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)phenyl]methyl]-2,3-dihydroindol-5-yl]acetamide (PubChem CID 118428793) has the molecular formula C21H20F6N2O and a molecular weight of 430.39 g/mol. Its IUPAC name is N-[1-[[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)phenyl]methyl]-2,3-dihydroindol-5-yl]acetamide.
| Compound Name | N-[1-[[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)phenyl]methyl]-2,3-dihydroindol-5-yl]acetamide |
|---|---|
| PubChem CID | 118428793 |
| Molecular Formula | C21H20F6N2O |
| Molecular Weight | 430.39 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | N-[1-[[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)phenyl]methyl]-2,3-dihydroindol-5-yl]acetamide |
| SMILES | CC(=O)Nc1ccc2c(c1)CCN2Cc1ccc(C(C)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H20F6N2O/c1-13(30)28-17-7-8-18-15(11-17)9-10-29(18)12-14-3-5-16(6-4-14)19(2,20(22,23)24)21(25,26)27/h3-8,11H,9-10,12H2,1-2H3,(H,28,30) |
| InChIKey | WZMAGKCJXIBGGL-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.39 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|