C23H33NO3 — CID 11842949
ethyl (1R,5S,9S)-9-hydroxy-3-(3-phenylpropyl)-5-prop-2-enyl-3-azabicyclo[3.3.1]nonane-1-carboxylate (PubChem CID 11842949) has the molecular formula C23H33NO3 and a molecular weight of 371.52 g/mol. Its IUPAC name is ethyl (1R,5S,9S)-9-hydroxy-3-(3-phenylpropyl)-5-prop-2-enyl-3-azabicyclo[3.3.1]nonane-1-carboxylate.
| Compound Name | ethyl (1R,5S,9S)-9-hydroxy-3-(3-phenylpropyl)-5-prop-2-enyl-3-azabicyclo[3.3.1]nonane-1-carboxylate |
|---|---|
| PubChem CID | 11842949 |
| Molecular Formula | C23H33NO3 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | ethyl (1R,5S,9S)-9-hydroxy-3-(3-phenylpropyl)-5-prop-2-enyl-3-azabicyclo[3.3.1]nonane-1-carboxylate |
| SMILES | C=CC[C@@]12CCC[C@@](C(=O)OCC)(CN(CCCc3ccccc3)C1)[C@H]2O |
| InChI | InChI=1S/C23H33NO3/c1-3-13-22-14-9-15-23(20(22)25,21(26)27-4-2)18-24(17-22)16-8-12-19-10-6-5-7-11-19/h3,5-7,10-11,20,25H,1,4,8-9,12-18H2,2H3/t20-,22+,23+/m0/s1 |
| InChIKey | UZQKIPPDAFVEQY-MDNUFGMLSA-N |
| XLogP | 3.59 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|