About (4-benzoylphenyl)methyl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate
(4-benzoylphenyl)methyl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate (PubChem CID 11842989) has the molecular formula C26H22N2O3
and a molecular weight of 410.47 g/mol. Its IUPAC name is (4-benzoylphenyl)methyl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate.
Molecular Properties
| Compound Name | (4-benzoylphenyl)methyl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate |
| PubChem CID | 11842989 |
| Molecular Formula | C26H22N2O3 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | (4-benzoylphenyl)methyl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate |
| SMILES | C[C@H](c1ccccc1)n1cncc1C(=O)OCc1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H22N2O3/c1-19(21-8-4-2-5-9-21)28-18-27-16-24(28)26(30)31-17-20-12-14-23(15-13-20)25(29)22-10-6-3-7-11-22/h2-16,18-19H,17H2,1H3/t19-/m1/s1 |
| InChIKey | WVZMDIKZVKSPKS-LJQANCHMSA-N |
| XLogP | 5.08 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-benzoylphenyl)methyl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-benzoylphenyl)methyl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate?
The IUPAC name of (4-benzoylphenyl)methyl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate (CID 11842989) is (4-benzoylphenyl)methyl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate.
What is the SMILES notation for (4-benzoylphenyl)methyl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate?
The canonical SMILES for (4-benzoylphenyl)methyl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate is C[C@H](c1ccccc1)n1cncc1C(=O)OCc1ccc(C(=O)c2ccccc2)cc1.
What is the InChIKey of (4-benzoylphenyl)methyl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate?
The InChIKey is WVZMDIKZVKSPKS-LJQANCHMSA-N. The full InChI is InChI=1S/C26H22N2O3/c1-19(21-8-4-2-5-9-21)28-18-27-16-24(28)26(30)31-17-20-12-14-23(15-13-20)25(29)22-10-6-3-7-11-22/h2-16,18-19H,17H2,1H3/t19-/m1/s1.
What are the key properties of (4-benzoylphenyl)methyl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate?
(4-benzoylphenyl)methyl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate has a molecular weight of 410.47 g/mol, XLogP of 5.08, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-benzoylphenyl)methyl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate is sourced from PubChem (CID 11842989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).