C23H28N4O — CID 118430398
2-(4-benzyl-5-methyl-3-pentan-3-yloxypyrazol-1-yl)-5-cyclopropylpyrimidine (PubChem CID 118430398) has the molecular formula C23H28N4O and a molecular weight of 376.50 g/mol. Its IUPAC name is 2-(4-benzyl-5-methyl-3-pentan-3-yloxypyrazol-1-yl)-5-cyclopropylpyrimidine.
| Compound Name | 2-(4-benzyl-5-methyl-3-pentan-3-yloxypyrazol-1-yl)-5-cyclopropylpyrimidine |
|---|---|
| PubChem CID | 118430398 |
| Molecular Formula | C23H28N4O |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | 2-(4-benzyl-5-methyl-3-pentan-3-yloxypyrazol-1-yl)-5-cyclopropylpyrimidine |
| SMILES | CCC(CC)Oc1nn(-c2ncc(C3CC3)cn2)c(C)c1Cc1ccccc1 |
| InChI | InChI=1S/C23H28N4O/c1-4-20(5-2)28-22-21(13-17-9-7-6-8-10-17)16(3)27(26-22)23-24-14-19(15-25-23)18-11-12-18/h6-10,14-15,18,20H,4-5,11-13H2,1-3H3 |
| InChIKey | WLFJOWROPCRLCZ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |