C18H31N7O — CID 118430754
3-(2-amino-5,5a,6,7,8,9,9a,10-octahydropyrido[2,3-g]quinazolin-8-yl)-1-[2-(dimethylamino)ethyl]-1-ethylurea (PubChem CID 118430754) has the molecular formula C18H31N7O and a molecular weight of 361.49 g/mol. Its IUPAC name is 3-(2-amino-5,5a,6,7,8,9,9a,10-octahydropyrido[2,3-g]quinazolin-8-yl)-1-[2-(dimethylamino)ethyl]-1-ethylurea.
| Compound Name | 3-(2-amino-5,5a,6,7,8,9,9a,10-octahydropyrido[2,3-g]quinazolin-8-yl)-1-[2-(dimethylamino)ethyl]-1-ethylurea |
|---|---|
| PubChem CID | 118430754 |
| Molecular Formula | C18H31N7O |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | 3-(2-amino-5,5a,6,7,8,9,9a,10-octahydropyrido[2,3-g]quinazolin-8-yl)-1-[2-(dimethylamino)ethyl]-1-ethylurea |
| SMILES | CCN(CCN(C)C)C(=O)NC1CNC2Cc3cnc(N)nc3CC2C1 |
| InChI | InChI=1S/C18H31N7O/c1-4-25(6-5-24(2)3)18(26)22-14-7-12-8-16-13(9-15(12)20-11-14)10-21-17(19)23-16/h10,12,14-15,20H,4-9,11H2,1-3H3,(H,22,26)(H2,19,21,23) |
| InChIKey | BHJWMTRKQLROQW-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |