C21H35N7O — CID 118430777
3-(2-amino-6-prop-2-enyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazolin-8-yl)-1-[2-(dimethylamino)ethyl]-1-ethylurea (PubChem CID 118430777) has the molecular formula C21H35N7O and a molecular weight of 401.56 g/mol. Its IUPAC name is 3-(2-amino-6-prop-2-enyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazolin-8-yl)-1-[2-(dimethylamino)ethyl]-1-ethylurea.
| Compound Name | 3-(2-amino-6-prop-2-enyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazolin-8-yl)-1-[2-(dimethylamino)ethyl]-1-ethylurea |
|---|---|
| PubChem CID | 118430777 |
| Molecular Formula | C21H35N7O |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.29 |
| IUPAC Name | 3-(2-amino-6-prop-2-enyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazolin-8-yl)-1-[2-(dimethylamino)ethyl]-1-ethylurea |
| SMILES | C=CCN1CC(NC(=O)N(CC)CCN(C)C)CC2Cc3nc(N)ncc3CC21 |
| InChI | InChI=1S/C21H35N7O/c1-5-7-28-14-17(24-21(29)27(6-2)9-8-26(3)4)10-15-11-18-16(12-19(15)28)13-23-20(22)25-18/h5,13,15,17,19H,1,6-12,14H2,2-4H3,(H,24,29)(H2,22,23,25) |
| InChIKey | GAKXHZFGIZOXBH-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 90.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|