About 5-bromo-6-cyclohexyl-1,3-dihydroimidazo[4,5-b]pyrazin-2-one
5-bromo-6-cyclohexyl-1,3-dihydroimidazo[4,5-b]pyrazin-2-one (PubChem CID 118431154) has the molecular formula C11H13BrN4O
and a molecular weight of 297.16 g/mol. Its IUPAC name is 5-bromo-6-cyclohexyl-1,3-dihydroimidazo[4,5-b]pyrazin-2-one.
Molecular Properties
| Compound Name | 5-bromo-6-cyclohexyl-1,3-dihydroimidazo[4,5-b]pyrazin-2-one |
| PubChem CID | 118431154 |
| Molecular Formula | C11H13BrN4O |
| Molecular Weight | 297.16 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 5-bromo-6-cyclohexyl-1,3-dihydroimidazo[4,5-b]pyrazin-2-one |
| SMILES | O=c1[nH]c2nc(Br)c(C3CCCCC3)nc2[nH]1 |
| InChI | InChI=1S/C11H13BrN4O/c12-8-7(6-4-2-1-3-5-6)13-9-10(14-8)16-11(17)15-9/h6H,1-5H2,(H2,13,14,15,16,17) |
| InChIKey | CPVPBTVOQKZANM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.16 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-6-cyclohexyl-1,3-dihydroimidazo[4,5-b]pyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-6-cyclohexyl-1,3-dihydroimidazo[4,5-b]pyrazin-2-one?
The IUPAC name of 5-bromo-6-cyclohexyl-1,3-dihydroimidazo[4,5-b]pyrazin-2-one (CID 118431154) is 5-bromo-6-cyclohexyl-1,3-dihydroimidazo[4,5-b]pyrazin-2-one.
What is the SMILES notation for 5-bromo-6-cyclohexyl-1,3-dihydroimidazo[4,5-b]pyrazin-2-one?
The canonical SMILES for 5-bromo-6-cyclohexyl-1,3-dihydroimidazo[4,5-b]pyrazin-2-one is O=c1[nH]c2nc(Br)c(C3CCCCC3)nc2[nH]1.
What is the InChIKey of 5-bromo-6-cyclohexyl-1,3-dihydroimidazo[4,5-b]pyrazin-2-one?
The InChIKey is CPVPBTVOQKZANM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BrN4O/c12-8-7(6-4-2-1-3-5-6)13-9-10(14-8)16-11(17)15-9/h6H,1-5H2,(H2,13,14,15,16,17).
What are the key properties of 5-bromo-6-cyclohexyl-1,3-dihydroimidazo[4,5-b]pyrazin-2-one?
5-bromo-6-cyclohexyl-1,3-dihydroimidazo[4,5-b]pyrazin-2-one has a molecular weight of 297.16 g/mol, XLogP of 2.46, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-6-cyclohexyl-1,3-dihydroimidazo[4,5-b]pyrazin-2-one is sourced from PubChem (CID 118431154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).