C26H39FN2O6 — CID 118431329
1-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dipropyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-3-[(2Z)-3,7-dimethylocta-2,6-dienyl]-5-fluoropyrimidine-2,4-dione (PubChem CID 118431329) has the molecular formula C26H39FN2O6 and a molecular weight of 494.60 g/mol. Its IUPAC name is 1-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dipropyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-3-[(2Z)-3,7-dimethylocta-2,6-dienyl]-5-fluoropyrimidine-2,4-dione.
| Compound Name | 1-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dipropyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-3-[(2Z)-3,7-dimethylocta-2,6-dienyl]-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 118431329 |
| Molecular Formula | C26H39FN2O6 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.28 |
| IUPAC Name | 1-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dipropyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-3-[(2Z)-3,7-dimethylocta-2,6-dienyl]-5-fluoropyrimidine-2,4-dione |
| SMILES | CCCC1(CCC)O[C@@H]2[C@H](O1)[C@@H](CO)O[C@H]2n1cc(F)c(=O)n(C/C=C(/C)CCC=C(C)C)c1=O |
| InChI | InChI=1S/C26H39FN2O6/c1-6-12-26(13-7-2)34-21-20(16-30)33-24(22(21)35-26)29-15-19(27)23(31)28(25(29)32)14-11-18(5)10-8-9-17(3)4/h9,11,15,20-22,24,30H,6-8,10,12-14,16H2,1-5H3/b18-11-/t20-,21-,22-,24-/m1/s1 |
| InChIKey | WPAQAQWPRLEISU-QCOXTXHASA-N |
| XLogP | 3.81 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|