C24H35FN2O6 — CID 118431340
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoro-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]pyrimidine-2,4-dione (PubChem CID 118431340) has the molecular formula C24H35FN2O6 and a molecular weight of 466.55 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoro-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoro-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 118431340 |
| Molecular Formula | C24H35FN2O6 |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoro-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]pyrimidine-2,4-dione |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/Cn1c(=O)c(F)cn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c1=O |
| InChI | InChI=1S/C24H35FN2O6/c1-15(2)7-5-8-16(3)9-6-10-17(4)11-12-26-22(31)18(25)13-27(24(26)32)23-21(30)20(29)19(14-28)33-23/h7,9,11,13,19-21,23,28-30H,5-6,8,10,12,14H2,1-4H3/b16-9+,17-11+/t19-,20-,21-,23-/m1/s1 |
| InChIKey | AGCLCFXFVATFCG-MCYUFVJESA-N |
| XLogP | 2.18 |
| TPSA | 113.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|