C28H47FN2O6 — CID 118431345
1-[(3aS,4R,6R,6aR)-6-(hydroxymethyl)-2,2-di(nonyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-5-fluoropyrimidine-2,4-dione (PubChem CID 118431345) has the molecular formula C28H47FN2O6 and a molecular weight of 526.69 g/mol. Its IUPAC name is 1-[(3aS,4R,6R,6aR)-6-(hydroxymethyl)-2,2-di(nonyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-5-fluoropyrimidine-2,4-dione.
| Compound Name | 1-[(3aS,4R,6R,6aR)-6-(hydroxymethyl)-2,2-di(nonyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 118431345 |
| Molecular Formula | C28H47FN2O6 |
| Molecular Weight | 526.69 g/mol |
| Exact Mass | 526.34 |
| IUPAC Name | 1-[(3aS,4R,6R,6aR)-6-(hydroxymethyl)-2,2-di(nonyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-5-fluoropyrimidine-2,4-dione |
| SMILES | CCCCCCCCCC1(CCCCCCCCC)O[C@H]2[C@H](O1)[C@@H](CO)O[C@H]2n1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C28H47FN2O6/c1-3-5-7-9-11-13-15-17-28(18-16-14-12-10-8-6-4-2)36-23-22(20-32)35-26(24(23)37-28)31-19-21(29)25(33)30-27(31)34/h19,22-24,26,32H,3-18,20H2,1-2H3,(H,30,33,34)/t22-,23-,24+,26-/m1/s1 |
| InChIKey | UABMWCZYGDMIGM-QJXQVQFTSA-N |
| XLogP | 5.33 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.69 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|