C20H15ClF2N2O2 — CID 118431507
5-chloro-2-[[6-[2-[2-(2,4-difluorophenyl)ethyl]oxiran-2-yl]-3-pyridinyl]oxy]pyridine (PubChem CID 118431507) has the molecular formula C20H15ClF2N2O2 and a molecular weight of 388.80 g/mol. Its IUPAC name is 5-chloro-2-[[6-[2-[2-(2,4-difluorophenyl)ethyl]oxiran-2-yl]-3-pyridinyl]oxy]pyridine.
| Compound Name | 5-chloro-2-[[6-[2-[2-(2,4-difluorophenyl)ethyl]oxiran-2-yl]-3-pyridinyl]oxy]pyridine |
|---|---|
| PubChem CID | 118431507 |
| Molecular Formula | C20H15ClF2N2O2 |
| Molecular Weight | 388.80 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 5-chloro-2-[[6-[2-[2-(2,4-difluorophenyl)ethyl]oxiran-2-yl]-3-pyridinyl]oxy]pyridine |
| SMILES | Fc1ccc(CCC2(c3ccc(Oc4ccc(Cl)cn4)cn3)CO2)c(F)c1 |
| InChI | InChI=1S/C20H15ClF2N2O2/c21-14-2-6-19(25-10-14)27-16-4-5-18(24-11-16)20(12-26-20)8-7-13-1-3-15(22)9-17(13)23/h1-6,9-11H,7-8,12H2 |
| InChIKey | QMNOWENAGDYXGL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 47.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.80 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|