C28H31ClF6N4O3 — CID 118431616
tert-butyl 4-[4-[2-(2-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]-1,4-diazepane-1-carboxylate (PubChem CID 118431616) has the molecular formula C28H31ClF6N4O3 and a molecular weight of 621.02 g/mol. Its IUPAC name is tert-butyl 4-[4-[2-(2-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[2-(2-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 118431616 |
| Molecular Formula | C28H31ClF6N4O3 |
| Molecular Weight | 621.02 g/mol |
| Exact Mass | 620.20 |
| IUPAC Name | tert-butyl 4-[4-[2-(2-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]-1,4-diazepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCN(c2ccc(C3CC(C(O)(C(F)(F)F)C(F)(F)F)=NN3c3ccccc3Cl)cc2)CC1 |
| InChI | InChI=1S/C28H31ClF6N4O3/c1-25(2,3)42-24(40)38-14-6-13-37(15-16-38)19-11-9-18(10-12-19)22-17-23(26(41,27(30,31)32)28(33,34)35)36-39(22)21-8-5-4-7-20(21)29/h4-5,7-12,22,41H,6,13-17H2,1-3H3 |
| InChIKey | KHOIZRDNLHGRDT-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 68.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.02 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|