C27H28F8N4O3 — CID 118431619
tert-butyl 4-[4-[2-(2,4-difluorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]piperazine-1-carboxylate (PubChem CID 118431619) has the molecular formula C27H28F8N4O3 and a molecular weight of 608.53 g/mol. Its IUPAC name is tert-butyl 4-[4-[2-(2,4-difluorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[2-(2,4-difluorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 118431619 |
| Molecular Formula | C27H28F8N4O3 |
| Molecular Weight | 608.53 g/mol |
| Exact Mass | 608.20 |
| IUPAC Name | tert-butyl 4-[4-[2-(2,4-difluorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(C3CC(C(O)(C(F)(F)F)C(F)(F)F)=NN3c3ccc(F)cc3F)cc2)CC1 |
| InChI | InChI=1S/C27H28F8N4O3/c1-24(2,3)42-23(40)38-12-10-37(11-13-38)18-7-4-16(5-8-18)21-15-22(25(41,26(30,31)32)27(33,34)35)36-39(21)20-9-6-17(28)14-19(20)29/h4-9,14,21,41H,10-13,15H2,1-3H3 |
| InChIKey | TXHHWQNAGRYYOY-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 68.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.53 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|