C23H25ClF5N5O2S — CID 118431631
4-[3-[2-(2-chlorophenyl)-5-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazol-3-yl]phenyl]-N,N-dimethylpiperazine-1-sulfonamide (PubChem CID 118431631) has the molecular formula C23H25ClF5N5O2S and a molecular weight of 566.00 g/mol. Its IUPAC name is 4-[3-[2-(2-chlorophenyl)-5-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazol-3-yl]phenyl]-N,N-dimethylpiperazine-1-sulfonamide.
| Compound Name | 4-[3-[2-(2-chlorophenyl)-5-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazol-3-yl]phenyl]-N,N-dimethylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 118431631 |
| Molecular Formula | C23H25ClF5N5O2S |
| Molecular Weight | 566.00 g/mol |
| Exact Mass | 565.13 |
| IUPAC Name | 4-[3-[2-(2-chlorophenyl)-5-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazol-3-yl]phenyl]-N,N-dimethylpiperazine-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCN(c2cccc(C3CC(C(F)(F)C(F)(F)F)=NN3c3ccccc3Cl)c2)CC1 |
| InChI | InChI=1S/C23H25ClF5N5O2S/c1-31(2)37(35,36)33-12-10-32(11-13-33)17-7-5-6-16(14-17)20-15-21(22(25,26)23(27,28)29)30-34(20)19-9-4-3-8-18(19)24/h3-9,14,20H,10-13,15H2,1-2H3 |
| InChIKey | IFJIIXXKSCPUGY-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 59.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.00 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|