C21H18ClF6N3OS — CID 118431634
2-[2-(2-chlorophenyl)-3-[5-(1,2,3,6-tetrahydropyridin-4-yl)thiophen-2-yl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 118431634) has the molecular formula C21H18ClF6N3OS and a molecular weight of 509.90 g/mol. Its IUPAC name is 2-[2-(2-chlorophenyl)-3-[5-(1,2,3,6-tetrahydropyridin-4-yl)thiophen-2-yl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[2-(2-chlorophenyl)-3-[5-(1,2,3,6-tetrahydropyridin-4-yl)thiophen-2-yl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 118431634 |
| Molecular Formula | C21H18ClF6N3OS |
| Molecular Weight | 509.90 g/mol |
| Exact Mass | 509.08 |
| IUPAC Name | 2-[2-(2-chlorophenyl)-3-[5-(1,2,3,6-tetrahydropyridin-4-yl)thiophen-2-yl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | OC(C1=NN(c2ccccc2Cl)C(c2ccc(C3=CCNCC3)s2)C1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C21H18ClF6N3OS/c22-13-3-1-2-4-14(13)31-15(17-6-5-16(33-17)12-7-9-29-10-8-12)11-18(30-31)19(32,20(23,24)25)21(26,27)28/h1-7,15,29,32H,8-11H2 |
| InChIKey | VBQIJUZJWLSHML-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.90 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |