C24H17Cl2F5N2OS — CID 118431636
2-(2,4-dichlorophenyl)-3-[3-(4-methylsulfinylphenyl)phenyl]-5-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazole (PubChem CID 118431636) has the molecular formula C24H17Cl2F5N2OS and a molecular weight of 547.38 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-3-[3-(4-methylsulfinylphenyl)phenyl]-5-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazole.
| Compound Name | 2-(2,4-dichlorophenyl)-3-[3-(4-methylsulfinylphenyl)phenyl]-5-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 118431636 |
| Molecular Formula | C24H17Cl2F5N2OS |
| Molecular Weight | 547.38 g/mol |
| Exact Mass | 546.04 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-3-[3-(4-methylsulfinylphenyl)phenyl]-5-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazole |
| SMILES | CS(=O)c1ccc(-c2cccc(C3CC(C(F)(F)C(F)(F)F)=NN3c3ccc(Cl)cc3Cl)c2)cc1 |
| InChI | InChI=1S/C24H17Cl2F5N2OS/c1-35(34)18-8-5-14(6-9-18)15-3-2-4-16(11-15)21-13-22(23(27,28)24(29,30)31)32-33(21)20-10-7-17(25)12-19(20)26/h2-12,21H,13H2,1H3 |
| InChIKey | YESYTQXWXQTTHM-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.38 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|