C24H16ClF7N2O — CID 118431637
2-[2-(2-chlorophenyl)-3-[4-(4-fluorophenyl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 118431637) has the molecular formula C24H16ClF7N2O and a molecular weight of 516.84 g/mol. Its IUPAC name is 2-[2-(2-chlorophenyl)-3-[4-(4-fluorophenyl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[2-(2-chlorophenyl)-3-[4-(4-fluorophenyl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 118431637 |
| Molecular Formula | C24H16ClF7N2O |
| Molecular Weight | 516.84 g/mol |
| Exact Mass | 516.08 |
| IUPAC Name | 2-[2-(2-chlorophenyl)-3-[4-(4-fluorophenyl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | OC(C1=NN(c2ccccc2Cl)C(c2ccc(-c3ccc(F)cc3)cc2)C1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C24H16ClF7N2O/c25-18-3-1-2-4-19(18)34-20(13-21(33-34)22(35,23(27,28)29)24(30,31)32)16-7-5-14(6-8-16)15-9-11-17(26)12-10-15/h1-12,20,35H,13H2 |
| InChIKey | XIXGRGKJUFSLHP-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.84 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |