C24H25ClF6N4O3S — CID 118431651
2-[2-(2-chlorophenyl)-3-[4-(4-ethylsulfonylpiperazin-1-yl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 118431651) has the molecular formula C24H25ClF6N4O3S and a molecular weight of 599.00 g/mol. Its IUPAC name is 2-[2-(2-chlorophenyl)-3-[4-(4-ethylsulfonylpiperazin-1-yl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[2-(2-chlorophenyl)-3-[4-(4-ethylsulfonylpiperazin-1-yl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 118431651 |
| Molecular Formula | C24H25ClF6N4O3S |
| Molecular Weight | 599.00 g/mol |
| Exact Mass | 598.12 |
| IUPAC Name | 2-[2-(2-chlorophenyl)-3-[4-(4-ethylsulfonylpiperazin-1-yl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCS(=O)(=O)N1CCN(c2ccc(C3CC(C(O)(C(F)(F)F)C(F)(F)F)=NN3c3ccccc3Cl)cc2)CC1 |
| InChI | InChI=1S/C24H25ClF6N4O3S/c1-2-39(37,38)34-13-11-33(12-14-34)17-9-7-16(8-10-17)20-15-21(22(36,23(26,27)28)24(29,30)31)32-35(20)19-6-4-3-5-18(19)25/h3-10,20,36H,2,11-15H2,1H3 |
| InChIKey | RVSVTGGOOBZKIV-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 76.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.00 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|