C25H17ClF8N2O3S — CID 118431661
2-[2-(2-chlorophenyl)-3-[4-(2,6-difluoro-4-methylsulfonylphenyl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 118431661) has the molecular formula C25H17ClF8N2O3S and a molecular weight of 612.93 g/mol. Its IUPAC name is 2-[2-(2-chlorophenyl)-3-[4-(2,6-difluoro-4-methylsulfonylphenyl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[2-(2-chlorophenyl)-3-[4-(2,6-difluoro-4-methylsulfonylphenyl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 118431661 |
| Molecular Formula | C25H17ClF8N2O3S |
| Molecular Weight | 612.93 g/mol |
| Exact Mass | 612.05 |
| IUPAC Name | 2-[2-(2-chlorophenyl)-3-[4-(2,6-difluoro-4-methylsulfonylphenyl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CS(=O)(=O)c1cc(F)c(-c2ccc(C3CC(C(O)(C(F)(F)F)C(F)(F)F)=NN3c3ccccc3Cl)cc2)c(F)c1 |
| InChI | InChI=1S/C25H17ClF8N2O3S/c1-40(38,39)15-10-17(27)22(18(28)11-15)14-8-6-13(7-9-14)20-12-21(23(37,24(29,30)31)25(32,33)34)35-36(20)19-5-3-2-4-16(19)26/h2-11,20,37H,12H2,1H3 |
| InChIKey | NQZQUGIMLXNZAW-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.93 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |