C26H24ClF6N3O3S — CID 118431665
2-[3-(2-chlorophenyl)-2-[4-(1-cyclopropylsulfonyl-3,6-dihydro-2H-pyridin-4-yl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 118431665) has the molecular formula C26H24ClF6N3O3S and a molecular weight of 608.00 g/mol. Its IUPAC name is 2-[3-(2-chlorophenyl)-2-[4-(1-cyclopropylsulfonyl-3,6-dihydro-2H-pyridin-4-yl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[3-(2-chlorophenyl)-2-[4-(1-cyclopropylsulfonyl-3,6-dihydro-2H-pyridin-4-yl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 118431665 |
| Molecular Formula | C26H24ClF6N3O3S |
| Molecular Weight | 608.00 g/mol |
| Exact Mass | 607.11 |
| IUPAC Name | 2-[3-(2-chlorophenyl)-2-[4-(1-cyclopropylsulfonyl-3,6-dihydro-2H-pyridin-4-yl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | O=S(=O)(C1CC1)N1CC=C(c2ccc(N3N=C(C(O)(C(F)(F)F)C(F)(F)F)CC3c3ccccc3Cl)cc2)CC1 |
| InChI | InChI=1S/C26H24ClF6N3O3S/c27-21-4-2-1-3-20(21)22-15-23(24(37,25(28,29)30)26(31,32)33)34-36(22)18-7-5-16(6-8-18)17-11-13-35(14-12-17)40(38,39)19-9-10-19/h1-8,11,19,22,37H,9-10,12-15H2 |
| InChIKey | PFCSUZWQNGZDMC-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 73.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.00 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |