C25H25ClF6N4O3S — CID 118431676
4-[3-[2-(2-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]-N,N-dimethyl-3,6-dihydro-2H-pyridine-1-sulfonamide (PubChem CID 118431676) has the molecular formula C25H25ClF6N4O3S and a molecular weight of 611.01 g/mol. Its IUPAC name is 4-[3-[2-(2-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]-N,N-dimethyl-3,6-dihydro-2H-pyridine-1-sulfonamide.
| Compound Name | 4-[3-[2-(2-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]-N,N-dimethyl-3,6-dihydro-2H-pyridine-1-sulfonamide |
|---|---|
| PubChem CID | 118431676 |
| Molecular Formula | C25H25ClF6N4O3S |
| Molecular Weight | 611.01 g/mol |
| Exact Mass | 610.12 |
| IUPAC Name | 4-[3-[2-(2-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]-N,N-dimethyl-3,6-dihydro-2H-pyridine-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CC=C(c2cccc(C3CC(C(O)(C(F)(F)F)C(F)(F)F)=NN3c3ccccc3Cl)c2)CC1 |
| InChI | InChI=1S/C25H25ClF6N4O3S/c1-34(2)40(38,39)35-12-10-16(11-13-35)17-6-5-7-18(14-17)21-15-22(23(37,24(27,28)29)25(30,31)32)33-36(21)20-9-4-3-8-19(20)26/h3-10,14,21,37H,11-13,15H2,1-2H3 |
| InChIKey | UDYXWAPYZMNBOL-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 76.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.01 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |