C24H22ClF6N3O3S — CID 118431678
2-[3-(2-chlorophenyl)-2-[3-(1-methylsulfonyl-3,6-dihydro-2H-pyridin-4-yl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 118431678) has the molecular formula C24H22ClF6N3O3S and a molecular weight of 581.97 g/mol. Its IUPAC name is 2-[3-(2-chlorophenyl)-2-[3-(1-methylsulfonyl-3,6-dihydro-2H-pyridin-4-yl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[3-(2-chlorophenyl)-2-[3-(1-methylsulfonyl-3,6-dihydro-2H-pyridin-4-yl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 118431678 |
| Molecular Formula | C24H22ClF6N3O3S |
| Molecular Weight | 581.97 g/mol |
| Exact Mass | 581.10 |
| IUPAC Name | 2-[3-(2-chlorophenyl)-2-[3-(1-methylsulfonyl-3,6-dihydro-2H-pyridin-4-yl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CS(=O)(=O)N1CC=C(c2cccc(N3N=C(C(O)(C(F)(F)F)C(F)(F)F)CC3c3ccccc3Cl)c2)CC1 |
| InChI | InChI=1S/C24H22ClF6N3O3S/c1-38(36,37)33-11-9-15(10-12-33)16-5-4-6-17(13-16)34-20(18-7-2-3-8-19(18)25)14-21(32-34)22(35,23(26,27)28)24(29,30)31/h2-9,13,20,35H,10-12,14H2,1H3 |
| InChIKey | SPQUKKXNDKKOAU-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 73.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.97 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |