C25H18ClF7N2OS — CID 118431680
2-[2-(2-chlorophenyl)-3-[3-fluoro-4-(4-methylsulfanylphenyl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 118431680) has the molecular formula C25H18ClF7N2OS and a molecular weight of 562.94 g/mol. Its IUPAC name is 2-[2-(2-chlorophenyl)-3-[3-fluoro-4-(4-methylsulfanylphenyl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[2-(2-chlorophenyl)-3-[3-fluoro-4-(4-methylsulfanylphenyl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 118431680 |
| Molecular Formula | C25H18ClF7N2OS |
| Molecular Weight | 562.94 g/mol |
| Exact Mass | 562.07 |
| IUPAC Name | 2-[2-(2-chlorophenyl)-3-[3-fluoro-4-(4-methylsulfanylphenyl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CSc1ccc(-c2ccc(C3CC(C(O)(C(F)(F)F)C(F)(F)F)=NN3c3ccccc3Cl)cc2F)cc1 |
| InChI | InChI=1S/C25H18ClF7N2OS/c1-37-16-9-6-14(7-10-16)17-11-8-15(12-19(17)27)21-13-22(23(36,24(28,29)30)25(31,32)33)34-35(21)20-5-3-2-4-18(20)26/h2-12,21,36H,13H2,1H3 |
| InChIKey | BPENVXHUJVQRBF-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.94 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |