C22H21ClF6N4O — CID 118431686
2-[2-(2-chlorophenyl)-3-(4-piperazin-1-ylphenyl)-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 118431686) has the molecular formula C22H21ClF6N4O and a molecular weight of 506.88 g/mol. Its IUPAC name is 2-[2-(2-chlorophenyl)-3-(4-piperazin-1-ylphenyl)-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[2-(2-chlorophenyl)-3-(4-piperazin-1-ylphenyl)-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 118431686 |
| Molecular Formula | C22H21ClF6N4O |
| Molecular Weight | 506.88 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | 2-[2-(2-chlorophenyl)-3-(4-piperazin-1-ylphenyl)-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | OC(C1=NN(c2ccccc2Cl)C(c2ccc(N3CCNCC3)cc2)C1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C22H21ClF6N4O/c23-16-3-1-2-4-17(16)33-18(13-19(31-33)20(34,21(24,25)26)22(27,28)29)14-5-7-15(8-6-14)32-11-9-30-10-12-32/h1-8,18,30,34H,9-13H2 |
| InChIKey | GTKBZJCMMCTMOA-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.88 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|