C26H27ClF6N4O2 — CID 118431689
1-[4-[4-[2-(2-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]piperazin-1-yl]-2-methylpropan-1-one (PubChem CID 118431689) has the molecular formula C26H27ClF6N4O2 and a molecular weight of 576.97 g/mol. Its IUPAC name is 1-[4-[4-[2-(2-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]piperazin-1-yl]-2-methylpropan-1-one.
| Compound Name | 1-[4-[4-[2-(2-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]piperazin-1-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 118431689 |
| Molecular Formula | C26H27ClF6N4O2 |
| Molecular Weight | 576.97 g/mol |
| Exact Mass | 576.17 |
| IUPAC Name | 1-[4-[4-[2-(2-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]piperazin-1-yl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)N1CCN(c2ccc(C3CC(C(O)(C(F)(F)F)C(F)(F)F)=NN3c3ccccc3Cl)cc2)CC1 |
| InChI | InChI=1S/C26H27ClF6N4O2/c1-16(2)23(38)36-13-11-35(12-14-36)18-9-7-17(8-10-18)21-15-22(24(39,25(28,29)30)26(31,32)33)34-37(21)20-6-4-3-5-19(20)27/h3-10,16,21,39H,11-15H2,1-2H3 |
| InChIKey | CENSPGFBBVOPHV-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.97 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|