C25H22ClF6N3O2 — CID 118431693
1-[4-[3-[2-(2-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]-3,6-dihydro-2H-pyridin-1-yl]ethanone (PubChem CID 118431693) has the molecular formula C25H22ClF6N3O2 and a molecular weight of 545.91 g/mol. Its IUPAC name is 1-[4-[3-[2-(2-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]-3,6-dihydro-2H-pyridin-1-yl]ethanone.
| Compound Name | 1-[4-[3-[2-(2-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]-3,6-dihydro-2H-pyridin-1-yl]ethanone |
|---|---|
| PubChem CID | 118431693 |
| Molecular Formula | C25H22ClF6N3O2 |
| Molecular Weight | 545.91 g/mol |
| Exact Mass | 545.13 |
| IUPAC Name | 1-[4-[3-[2-(2-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]-3,6-dihydro-2H-pyridin-1-yl]ethanone |
| SMILES | CC(=O)N1CC=C(c2cccc(C3CC(C(O)(C(F)(F)F)C(F)(F)F)=NN3c3ccccc3Cl)c2)CC1 |
| InChI | InChI=1S/C25H22ClF6N3O2/c1-15(36)34-11-9-16(10-12-34)17-5-4-6-18(13-17)21-14-22(23(37,24(27,28)29)25(30,31)32)33-35(21)20-8-3-2-7-19(20)26/h2-9,13,21,37H,10-12,14H2,1H3 |
| InChIKey | DZJUZPCAEKXVME-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 56.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.91 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |