C24H26ClF6N5O3S — CID 118431718
4-[4-[2-(2-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]-N,N-dimethylpiperazine-1-sulfonamide (PubChem CID 118431718) has the molecular formula C24H26ClF6N5O3S and a molecular weight of 614.01 g/mol. Its IUPAC name is 4-[4-[2-(2-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]-N,N-dimethylpiperazine-1-sulfonamide.
| Compound Name | 4-[4-[2-(2-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]-N,N-dimethylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 118431718 |
| Molecular Formula | C24H26ClF6N5O3S |
| Molecular Weight | 614.01 g/mol |
| Exact Mass | 613.13 |
| IUPAC Name | 4-[4-[2-(2-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]-N,N-dimethylpiperazine-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCN(c2ccc(C3CC(C(O)(C(F)(F)F)C(F)(F)F)=NN3c3ccccc3Cl)cc2)CC1 |
| InChI | InChI=1S/C24H26ClF6N5O3S/c1-33(2)40(38,39)35-13-11-34(12-14-35)17-9-7-16(8-10-17)20-15-21(22(37,23(26,27)28)24(29,30)31)32-36(20)19-6-4-3-5-18(19)25/h3-10,20,37H,11-15H2,1-2H3 |
| InChIKey | JVWXCLSDPANKDO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 79.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.01 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|