C23H23ClF6N4O3S — CID 118431719
2-[2-(2-chlorophenyl)-3-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 118431719) has the molecular formula C23H23ClF6N4O3S and a molecular weight of 584.97 g/mol. Its IUPAC name is 2-[2-(2-chlorophenyl)-3-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[2-(2-chlorophenyl)-3-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 118431719 |
| Molecular Formula | C23H23ClF6N4O3S |
| Molecular Weight | 584.97 g/mol |
| Exact Mass | 584.11 |
| IUPAC Name | 2-[2-(2-chlorophenyl)-3-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CS(=O)(=O)N1CCN(c2ccc(C3CC(C(O)(C(F)(F)F)C(F)(F)F)=NN3c3ccccc3Cl)cc2)CC1 |
| InChI | InChI=1S/C23H23ClF6N4O3S/c1-38(36,37)33-12-10-32(11-13-33)16-8-6-15(7-9-16)19-14-20(21(35,22(25,26)27)23(28,29)30)31-34(19)18-5-3-2-4-17(18)24/h2-9,19,35H,10-14H2,1H3 |
| InChIKey | ZDCKVUFBKJYSPT-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 76.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.97 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|