C28H28ClF6N3O3 — CID 118431730
tert-butyl 4-[3-[2-(2-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 118431730) has the molecular formula C28H28ClF6N3O3 and a molecular weight of 603.99 g/mol. Its IUPAC name is tert-butyl 4-[3-[2-(2-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[2-(2-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 118431730 |
| Molecular Formula | C28H28ClF6N3O3 |
| Molecular Weight | 603.99 g/mol |
| Exact Mass | 603.17 |
| IUPAC Name | tert-butyl 4-[3-[2-(2-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC=C(c2cccc(C3CC(C(O)(C(F)(F)F)C(F)(F)F)=NN3c3ccccc3Cl)c2)CC1 |
| InChI | InChI=1S/C28H28ClF6N3O3/c1-25(2,3)41-24(39)37-13-11-17(12-14-37)18-7-6-8-19(15-18)22-16-23(26(40,27(30,31)32)28(33,34)35)36-38(22)21-10-5-4-9-20(21)29/h4-11,15,22,40H,12-14,16H2,1-3H3 |
| InChIKey | UCWRDHCNFAQQQC-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 65.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.99 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |