C25H26ClF6N5O2 — CID 118431734
4-[4-[2-(2-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]-N,N-dimethylpiperazine-1-carboxamide (PubChem CID 118431734) has the molecular formula C25H26ClF6N5O2 and a molecular weight of 577.96 g/mol. Its IUPAC name is 4-[4-[2-(2-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]-N,N-dimethylpiperazine-1-carboxamide.
| Compound Name | 4-[4-[2-(2-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]-N,N-dimethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 118431734 |
| Molecular Formula | C25H26ClF6N5O2 |
| Molecular Weight | 577.96 g/mol |
| Exact Mass | 577.17 |
| IUPAC Name | 4-[4-[2-(2-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]-N,N-dimethylpiperazine-1-carboxamide |
| SMILES | CN(C)C(=O)N1CCN(c2ccc(C3CC(C(O)(C(F)(F)F)C(F)(F)F)=NN3c3ccccc3Cl)cc2)CC1 |
| InChI | InChI=1S/C25H26ClF6N5O2/c1-34(2)22(38)36-13-11-35(12-14-36)17-9-7-16(8-10-17)20-15-21(23(39,24(27,28)29)25(30,31)32)33-37(20)19-6-4-3-5-18(19)26/h3-10,20,39H,11-15H2,1-2H3 |
| InChIKey | PFFJFUXPMDJBDM-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 62.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.96 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|