C31H26ClF6N3O2 — CID 118431744
1-[4-[3-[2-(2-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]-3,6-dihydro-2H-pyridin-1-yl]-2-phenylethanone (PubChem CID 118431744) has the molecular formula C31H26ClF6N3O2 and a molecular weight of 622.01 g/mol. Its IUPAC name is 1-[4-[3-[2-(2-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]-3,6-dihydro-2H-pyridin-1-yl]-2-phenylethanone.
| Compound Name | 1-[4-[3-[2-(2-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]-3,6-dihydro-2H-pyridin-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 118431744 |
| Molecular Formula | C31H26ClF6N3O2 |
| Molecular Weight | 622.01 g/mol |
| Exact Mass | 621.16 |
| IUPAC Name | 1-[4-[3-[2-(2-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]-3,6-dihydro-2H-pyridin-1-yl]-2-phenylethanone |
| SMILES | O=C(Cc1ccccc1)N1CC=C(c2cccc(C3CC(C(O)(C(F)(F)F)C(F)(F)F)=NN3c3ccccc3Cl)c2)CC1 |
| InChI | InChI=1S/C31H26ClF6N3O2/c32-24-11-4-5-12-25(24)41-26(19-27(39-41)29(43,30(33,34)35)31(36,37)38)23-10-6-9-22(18-23)21-13-15-40(16-14-21)28(42)17-20-7-2-1-3-8-20/h1-13,18,26,43H,14-17,19H2 |
| InChIKey | HQBSOWZFQPHKCI-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 56.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.01 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |