C23H23ClF8N4O — CID 118431747
2-[3-[4-(1,4-diazepan-1-yl)phenyl]-2-(2,4-difluorophenyl)-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol;hydrochloride (PubChem CID 118431747) has the molecular formula C23H23ClF8N4O and a molecular weight of 558.90 g/mol. Its IUPAC name is 2-[3-[4-(1,4-diazepan-1-yl)phenyl]-2-(2,4-difluorophenyl)-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol;hydrochloride.
| Compound Name | 2-[3-[4-(1,4-diazepan-1-yl)phenyl]-2-(2,4-difluorophenyl)-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 118431747 |
| Molecular Formula | C23H23ClF8N4O |
| Molecular Weight | 558.90 g/mol |
| Exact Mass | 558.14 |
| IUPAC Name | 2-[3-[4-(1,4-diazepan-1-yl)phenyl]-2-(2,4-difluorophenyl)-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol;hydrochloride |
| SMILES | Cl.OC(C1=NN(c2ccc(F)cc2F)C(c2ccc(N3CCCNCC3)cc2)C1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C23H22F8N4O.ClH/c24-15-4-7-18(17(25)12-15)35-19(13-20(33-35)21(36,22(26,27)28)23(29,30)31)14-2-5-16(6-3-14)34-10-1-8-32-9-11-34;/h2-7,12,19,32,36H,1,8-11,13H2;1H |
| InChIKey | FQLKXWYVZKZULX-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.90 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|