C25H20ClF6N3O3S — CID 118431750
2-[3-[4-(2-amino-3-methylsulfonylphenyl)phenyl]-2-(2-chlorophenyl)-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 118431750) has the molecular formula C25H20ClF6N3O3S and a molecular weight of 591.96 g/mol. Its IUPAC name is 2-[3-[4-(2-amino-3-methylsulfonylphenyl)phenyl]-2-(2-chlorophenyl)-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[3-[4-(2-amino-3-methylsulfonylphenyl)phenyl]-2-(2-chlorophenyl)-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 118431750 |
| Molecular Formula | C25H20ClF6N3O3S |
| Molecular Weight | 591.96 g/mol |
| Exact Mass | 591.08 |
| IUPAC Name | 2-[3-[4-(2-amino-3-methylsulfonylphenyl)phenyl]-2-(2-chlorophenyl)-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CS(=O)(=O)c1cccc(-c2ccc(C3CC(C(O)(C(F)(F)F)C(F)(F)F)=NN3c3ccccc3Cl)cc2)c1N |
| InChI | InChI=1S/C25H20ClF6N3O3S/c1-39(37,38)20-8-4-5-16(22(20)33)14-9-11-15(12-10-14)19-13-21(23(36,24(27,28)29)25(30,31)32)34-35(19)18-7-3-2-6-17(18)26/h2-12,19,36H,13,33H2,1H3 |
| InChIKey | LFRUFKHKGAAHIQ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.96 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|